C35H48N3O9P — CID 146176555
5-[3-(dimethoxyphosphorylmethyl)-5-ethoxyphenyl]-N-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methyl]furan-2-carboxamide (PubChem CID 146176555) has the molecular formula C35H48N3O9P and a molecular weight of 685.76 g/mol. Its IUPAC name is 5-[3-(dimethoxyphosphorylmethyl)-5-ethoxyphenyl]-N-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methyl]furan-2-carboxamide.
| Compound Name | 5-[3-(dimethoxyphosphorylmethyl)-5-ethoxyphenyl]-N-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 146176555 |
| Molecular Formula | C35H48N3O9P |
| Molecular Weight | 685.76 g/mol |
| Exact Mass | 685.31 |
| IUPAC Name | 5-[3-(dimethoxyphosphorylmethyl)-5-ethoxyphenyl]-N-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methyl]furan-2-carboxamide |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(CP(=O)(OC)OC)cc(OCC)c2)o1)C(CC)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H48N3O9P/c1-6-9-11-16-30(31(7-2)38(25-39)46-22-26-14-12-10-13-15-26)34(40)36-24-37-35(41)33-18-17-32(47-33)28-19-27(20-29(21-28)45-8-3)23-48(42,43-4)44-5/h10,12-15,17-21,25,30-31H,6-9,11,16,22-24H2,1-5H3,(H,36,40)(H,37,41) |
| InChIKey | JVRMVXUOOMJRAR-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 145.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.76 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|