C45H58N3O11P — CID 137361524
[4-[[[5-[3-bis(phenylmethoxy)phosphoryl-5-ethoxyphenyl]furan-2-carbonyl]amino]methylcarbamoyl]nonan-3-yl-formylamino]oxymethyl 2,2-dimethylpropanoate (PubChem CID 137361524) has the molecular formula C45H58N3O11P and a molecular weight of 847.94 g/mol. Its IUPAC name is [4-[[[5-[3-bis(phenylmethoxy)phosphoryl-5-ethoxyphenyl]furan-2-carbonyl]amino]methylcarbamoyl]nonan-3-yl-formylamino]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [4-[[[5-[3-bis(phenylmethoxy)phosphoryl-5-ethoxyphenyl]furan-2-carbonyl]amino]methylcarbamoyl]nonan-3-yl-formylamino]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 137361524 |
| Molecular Formula | C45H58N3O11P |
| Molecular Weight | 847.94 g/mol |
| Exact Mass | 847.38 |
| IUPAC Name | [4-[[[5-[3-bis(phenylmethoxy)phosphoryl-5-ethoxyphenyl]furan-2-carbonyl]amino]methylcarbamoyl]nonan-3-yl-formylamino]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(P(=O)(OCc3ccccc3)OCc3ccccc3)c2)o1)C(CC)N(C=O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C45H58N3O11P/c1-7-10-13-22-38(39(8-2)48(31-49)56-32-55-44(52)45(4,5)6)42(50)46-30-47-43(51)41-24-23-40(59-41)35-25-36(54-9-3)27-37(26-35)60(53,57-28-33-18-14-11-15-19-33)58-29-34-20-16-12-17-21-34/h11-12,14-21,23-27,31,38-39H,7-10,13,22,28-30,32H2,1-6H3,(H,46,50)(H,47,51) |
| InChIKey | UVFXOOWFVKVSTQ-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 171.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.94 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|