C34H42N4O9 — CID 118226058
methyl 3-(2-amino-2-oxoethoxy)-5-[5-[[2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoate (PubChem CID 118226058) has the molecular formula C34H42N4O9 and a molecular weight of 650.73 g/mol. Its IUPAC name is methyl 3-(2-amino-2-oxoethoxy)-5-[5-[[2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoate.
| Compound Name | methyl 3-(2-amino-2-oxoethoxy)-5-[5-[[2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 118226058 |
| Molecular Formula | C34H42N4O9 |
| Molecular Weight | 650.73 g/mol |
| Exact Mass | 650.30 |
| IUPAC Name | methyl 3-(2-amino-2-oxoethoxy)-5-[5-[[2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoate |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(OCC(N)=O)cc(C(=O)OC)c2)o1)[C@@H](CC)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H42N4O9/c1-4-6-8-13-27(28(5-2)38(22-39)46-19-23-11-9-7-10-12-23)32(41)36-21-37-33(42)30-15-14-29(47-30)24-16-25(34(43)44-3)18-26(17-24)45-20-31(35)40/h7,9-12,14-18,22,27-28H,4-6,8,13,19-21H2,1-3H3,(H2,35,40)(H,36,41)(H,37,42)/t27?,28-/m1/s1 |
| InChIKey | GYZXBUMCXVHIGZ-PLYLYKGUSA-N |
| XLogP | 3.97 |
| TPSA | 179.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.73 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|