C35H43N3O10 — CID 123761926
methyl 3-[5-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-5-(2-methoxy-2-oxoethoxy)benzoate (PubChem CID 123761926) has the molecular formula C35H43N3O10 and a molecular weight of 665.74 g/mol. Its IUPAC name is methyl 3-[5-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-5-(2-methoxy-2-oxoethoxy)benzoate.
| Compound Name | methyl 3-[5-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-5-(2-methoxy-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 123761926 |
| Molecular Formula | C35H43N3O10 |
| Molecular Weight | 665.74 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | methyl 3-[5-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-5-(2-methoxy-2-oxoethoxy)benzoate |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(OCC(=O)OC)cc(C(=O)OC)c2)o1)C(CC)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H43N3O10/c1-5-7-9-14-28(29(6-2)38(23-39)47-20-24-12-10-8-11-13-24)33(41)36-22-37-34(42)31-16-15-30(48-31)25-17-26(35(43)45-4)19-27(18-25)46-21-32(40)44-3/h8,10-13,15-19,23,28-29H,5-7,9,14,20-22H2,1-4H3,(H,36,41)(H,37,42) |
| InChIKey | XUEVPEUDYJTLAH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 162.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.74 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|