C26H34N4O9 — CID 123999055
3-(2-amino-2-oxoethoxy)-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoic acid (PubChem CID 123999055) has the molecular formula C26H34N4O9 and a molecular weight of 546.58 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethoxy)-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoic acid.
| Compound Name | 3-(2-amino-2-oxoethoxy)-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 123999055 |
| Molecular Formula | C26H34N4O9 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 3-(2-amino-2-oxoethoxy)-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(OCC(N)=O)cc(C(=O)O)c2)o1)C(CC)N(O)C=O |
| InChI | InChI=1S/C26H34N4O9/c1-3-5-6-7-19(20(4-2)30(37)15-31)24(33)28-14-29-25(34)22-9-8-21(39-22)16-10-17(26(35)36)12-18(11-16)38-13-23(27)32/h8-12,15,19-20,37H,3-7,13-14H2,1-2H3,(H2,27,32)(H,28,33)(H,29,34)(H,35,36) |
| InChIKey | CIYVDOLHZQTJRJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 201.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|