C28H42N3O9P — CID 146199638
5-(3-dimethoxyphosphoryl-5-ethoxyphenyl)-N-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]octanoyl]amino]methyl]furan-2-carboxamide (PubChem CID 146199638) has the molecular formula C28H42N3O9P and a molecular weight of 595.63 g/mol. Its IUPAC name is 5-(3-dimethoxyphosphoryl-5-ethoxyphenyl)-N-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]octanoyl]amino]methyl]furan-2-carboxamide.
| Compound Name | 5-(3-dimethoxyphosphoryl-5-ethoxyphenyl)-N-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]octanoyl]amino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 146199638 |
| Molecular Formula | C28H42N3O9P |
| Molecular Weight | 595.63 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | 5-(3-dimethoxyphosphoryl-5-ethoxyphenyl)-N-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]octanoyl]amino]methyl]furan-2-carboxamide |
| SMILES | CCCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(P(=O)(OC)OC)c2)o1)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C28H42N3O9P/c1-6-9-10-11-12-23(24(7-2)31(35)19-32)27(33)29-18-30-28(34)26-14-13-25(40-26)20-15-21(39-8-3)17-22(16-20)41(36,37-4)38-5/h13-17,19,23-24,35H,6-12,18H2,1-5H3,(H,29,33)(H,30,34)/t23-,24-/m1/s1 |
| InChIKey | RLPXCIDVSUQRCE-DNQXCXABSA-N |
| XLogP | 4.47 |
| TPSA | 156.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|