C26H34FN3O8 — CID 118230906
3-ethoxy-2-fluoro-5-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoic acid (PubChem CID 118230906) has the molecular formula C26H34FN3O8 and a molecular weight of 535.57 g/mol. Its IUPAC name is 3-ethoxy-2-fluoro-5-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoic acid.
| Compound Name | 3-ethoxy-2-fluoro-5-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 118230906 |
| Molecular Formula | C26H34FN3O8 |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | 3-ethoxy-2-fluoro-5-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoic acid |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2cc(OCC)c(F)c(C(=O)O)c2)o1)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C26H34FN3O8/c1-4-7-8-9-17(19(5-2)30(36)15-31)24(32)28-14-29-25(33)21-11-10-20(38-21)16-12-18(26(34)35)23(27)22(13-16)37-6-3/h10-13,15,17,19,36H,4-9,14H2,1-3H3,(H,28,32)(H,29,33)(H,34,35)/t17-,19-/m1/s1 |
| InChIKey | NZZQNOHKPCQKKC-IEBWSBKVSA-N |
| XLogP | 3.81 |
| TPSA | 158.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|