C25H35N4O9P — CID 118225932
[[4-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methylphosphonic acid (PubChem CID 118225932) has the molecular formula C25H35N4O9P and a molecular weight of 566.55 g/mol. Its IUPAC name is [[4-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methylphosphonic acid.
| Compound Name | [[4-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 118225932 |
| Molecular Formula | C25H35N4O9P |
| Molecular Weight | 566.55 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | [[4-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methylphosphonic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2ccc(C(=O)NCP(=O)(O)O)cc2)o1)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C25H35N4O9P/c1-3-5-6-7-19(20(4-2)29(34)16-30)24(32)26-14-27-25(33)22-13-12-21(38-22)17-8-10-18(11-9-17)23(31)28-15-39(35,36)37/h8-13,16,19-20,34H,3-7,14-15H2,1-2H3,(H,26,32)(H,27,33)(H,28,31)(H2,35,36,37)/t19?,20-/m1/s1 |
| InChIKey | KGDLOJBSDRDZEH-GFOWMXPYSA-N |
| XLogP | 2.44 |
| TPSA | 198.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.55 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|