C25H34N4O9P+ — CID 122699080
[[4-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methoxy-hydroxy-oxophosphanium (PubChem CID 122699080) has the molecular formula C25H34N4O9P+ and a molecular weight of 565.54 g/mol. Its IUPAC name is [[4-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methoxy-hydroxy-oxophosphanium.
| Compound Name | [[4-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 122699080 |
| Molecular Formula | C25H34N4O9P+ |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | [[4-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methoxy-hydroxy-oxophosphanium |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2ccc(C(=O)NCO[P+](=O)O)cc2)o1)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C25H33N4O9P/c1-3-5-6-7-19(20(4-2)29(34)16-30)24(32)26-14-27-25(33)22-13-12-21(38-22)17-8-10-18(11-9-17)23(31)28-15-37-39(35)36/h8-13,16,19-20,34H,3-7,14-15H2,1-2H3,(H3-,26,27,28,31,32,33,35,36)/p+1/t19-,20-/m1/s1 |
| InChIKey | OZXYJWYTDZQHKB-WOJBJXKFSA-O |
| XLogP | 2.93 |
| TPSA | 187.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|