C27H38N4O10P+ — CID 146444720
[[2-ethoxy-4-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methoxy-hydroxy-oxophosphanium (PubChem CID 146444720) has the molecular formula C27H38N4O10P+ and a molecular weight of 609.59 g/mol. Its IUPAC name is [[2-ethoxy-4-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methoxy-hydroxy-oxophosphanium.
| Compound Name | [[2-ethoxy-4-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 146444720 |
| Molecular Formula | C27H38N4O10P+ |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | [[2-ethoxy-4-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methoxy-hydroxy-oxophosphanium |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2ccc(C(=O)NCO[P+](=O)O)c(OCC)c2)o1)C(CC)N(O)C=O |
| InChI | InChI=1S/C27H37N4O10P/c1-4-7-8-9-19(21(5-2)31(36)17-32)25(33)28-15-29-27(35)23-13-12-22(41-23)18-10-11-20(24(14-18)39-6-3)26(34)30-16-40-42(37)38/h10-14,17,19,21,36H,4-9,15-16H2,1-3H3,(H3-,28,29,30,33,34,35,37,38)/p+1 |
| InChIKey | OOCBMOBRXNGDAC-UHFFFAOYSA-O |
| XLogP | 3.33 |
| TPSA | 196.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|