C27H37N3O9 — CID 122699110
methyl 2-ethoxy-4-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-6-hydroxybenzoate (PubChem CID 122699110) has the molecular formula C27H37N3O9 and a molecular weight of 547.61 g/mol. Its IUPAC name is methyl 2-ethoxy-4-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-6-hydroxybenzoate.
| Compound Name | methyl 2-ethoxy-4-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-6-hydroxybenzoate |
|---|---|
| PubChem CID | 122699110 |
| Molecular Formula | C27H37N3O9 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | methyl 2-ethoxy-4-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-6-hydroxybenzoate |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(O)c(C(=O)OC)c(OCC)c2)o1)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C27H37N3O9/c1-5-8-9-10-18(19(6-2)30(36)16-31)25(33)28-15-29-26(34)22-12-11-21(39-22)17-13-20(32)24(27(35)37-4)23(14-17)38-7-3/h11-14,16,18-19,32,36H,5-10,15H2,1-4H3,(H,28,33)(H,29,34)/t18?,19-/m1/s1 |
| InChIKey | MPCDIJPEZPIFOW-MUMRKEEXSA-N |
| XLogP | 3.46 |
| TPSA | 167.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|