C26H35N3O9 — CID 141460753
2-ethoxy-6-hydroxy-4-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoic acid (PubChem CID 141460753) has the molecular formula C26H35N3O9 and a molecular weight of 533.58 g/mol. Its IUPAC name is 2-ethoxy-6-hydroxy-4-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoic acid.
| Compound Name | 2-ethoxy-6-hydroxy-4-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 141460753 |
| Molecular Formula | C26H35N3O9 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 2-ethoxy-6-hydroxy-4-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoic acid |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2cc(O)c(C(=O)O)c(OCC)c2)o1)[C@@H](CC)C(=O)NO |
| InChI | InChI=1S/C26H35N3O9/c1-4-7-8-9-17(16(5-2)24(32)29-36)23(31)27-14-28-25(33)20-11-10-19(38-20)15-12-18(30)22(26(34)35)21(13-15)37-6-3/h10-13,16-17,30,36H,4-9,14H2,1-3H3,(H,27,31)(H,28,33)(H,29,32)(H,34,35)/t16-,17-/m1/s1 |
| InChIKey | QCNCHZOJWULDGZ-IAGOWNOFSA-N |
| XLogP | 3.28 |
| TPSA | 187.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|