C25H32FN3O7 — CID 141460720
2-[2-fluoro-5-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]phenyl]acetic acid (PubChem CID 141460720) has the molecular formula C25H32FN3O7 and a molecular weight of 505.54 g/mol. Its IUPAC name is 2-[2-fluoro-5-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]phenyl]acetic acid.
| Compound Name | 2-[2-fluoro-5-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 141460720 |
| Molecular Formula | C25H32FN3O7 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 2-[2-fluoro-5-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]phenyl]acetic acid |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2ccc(F)c(CC(=O)O)c2)o1)[C@@H](CC)C(=O)NO |
| InChI | InChI=1S/C25H32FN3O7/c1-3-5-6-7-18(17(4-2)24(33)29-35)23(32)27-14-28-25(34)21-11-10-20(36-21)15-8-9-19(26)16(12-15)13-22(30)31/h8-12,17-18,35H,3-7,13-14H2,1-2H3,(H,27,32)(H,28,34)(H,29,33)(H,30,31)/t17-,18-/m1/s1 |
| InChIKey | WOJWFXFFIVYLKG-QZTJIDSGSA-N |
| XLogP | 3.24 |
| TPSA | 157.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|