C22H29N3O5S — CID 141460772
(2R)-N'-hydroxy-N-[[[5-(3-methylsulfanylphenyl)furan-2-carbonyl]amino]methyl]-2-pentylbutanediamide (PubChem CID 141460772) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is (2R)-N'-hydroxy-N-[[[5-(3-methylsulfanylphenyl)furan-2-carbonyl]amino]methyl]-2-pentylbutanediamide.
| Compound Name | (2R)-N'-hydroxy-N-[[[5-(3-methylsulfanylphenyl)furan-2-carbonyl]amino]methyl]-2-pentylbutanediamide |
|---|---|
| PubChem CID | 141460772 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (2R)-N'-hydroxy-N-[[[5-(3-methylsulfanylphenyl)furan-2-carbonyl]amino]methyl]-2-pentylbutanediamide |
| SMILES | CCCCC[C@H](CC(=O)NO)C(=O)NCNC(=O)c1ccc(-c2cccc(SC)c2)o1 |
| InChI | InChI=1S/C22H29N3O5S/c1-3-4-5-7-16(13-20(26)25-29)21(27)23-14-24-22(28)19-11-10-18(30-19)15-8-6-9-17(12-15)31-2/h6,8-12,16,29H,3-5,7,13-14H2,1-2H3,(H,23,27)(H,24,28)(H,25,26)/t16-/m1/s1 |
| InChIKey | XDYVEVMXISNQHI-MRXNPFEDSA-N |
| XLogP | 3.56 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|