C23H29N3O7 — CID 141460825
3-[5-[[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-methylbenzoic acid (PubChem CID 141460825) has the molecular formula C23H29N3O7 and a molecular weight of 459.50 g/mol. Its IUPAC name is 3-[5-[[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-methylbenzoic acid.
| Compound Name | 3-[5-[[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 141460825 |
| Molecular Formula | C23H29N3O7 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 3-[5-[[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-methylbenzoic acid |
| SMILES | CCCCC[C@H](CC(=O)NO)C(=O)NCNC(=O)c1ccc(-c2cccc(C(=O)O)c2C)o1 |
| InChI | InChI=1S/C23H29N3O7/c1-3-4-5-7-15(12-20(27)26-32)21(28)24-13-25-22(29)19-11-10-18(33-19)16-8-6-9-17(14(16)2)23(30)31/h6,8-11,15,32H,3-5,7,12-13H2,1-2H3,(H,24,28)(H,25,29)(H,26,27)(H,30,31)/t15-/m1/s1 |
| InChIKey | LDHVMSPWLQQOID-OAHLLOKOSA-N |
| XLogP | 2.85 |
| TPSA | 157.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|