C21H26N4O7 — CID 141460901
(2R)-N'-hydroxy-N-[[[5-(3-nitrophenyl)furan-2-carbonyl]amino]methyl]-2-pentylbutanediamide (PubChem CID 141460901) has the molecular formula C21H26N4O7 and a molecular weight of 446.46 g/mol. Its IUPAC name is (2R)-N'-hydroxy-N-[[[5-(3-nitrophenyl)furan-2-carbonyl]amino]methyl]-2-pentylbutanediamide.
| Compound Name | (2R)-N'-hydroxy-N-[[[5-(3-nitrophenyl)furan-2-carbonyl]amino]methyl]-2-pentylbutanediamide |
|---|---|
| PubChem CID | 141460901 |
| Molecular Formula | C21H26N4O7 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (2R)-N'-hydroxy-N-[[[5-(3-nitrophenyl)furan-2-carbonyl]amino]methyl]-2-pentylbutanediamide |
| SMILES | CCCCC[C@H](CC(=O)NO)C(=O)NCNC(=O)c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C21H26N4O7/c1-2-3-4-6-15(12-19(26)24-29)20(27)22-13-23-21(28)18-10-9-17(32-18)14-7-5-8-16(11-14)25(30)31/h5,7-11,15,29H,2-4,6,12-13H2,1H3,(H,22,27)(H,23,28)(H,24,26)/t15-/m1/s1 |
| InChIKey | KOFPOXFRYXREAX-OAHLLOKOSA-N |
| XLogP | 2.75 |
| TPSA | 163.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|