C30H34F3N3O6 — CID 118230978
N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]-5-[3-(2,2,2-trifluoroethoxy)phenyl]furan-2-carboxamide (PubChem CID 118230978) has the molecular formula C30H34F3N3O6 and a molecular weight of 589.61 g/mol. Its IUPAC name is N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]-5-[3-(2,2,2-trifluoroethoxy)phenyl]furan-2-carboxamide.
| Compound Name | N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]-5-[3-(2,2,2-trifluoroethoxy)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 118230978 |
| Molecular Formula | C30H34F3N3O6 |
| Molecular Weight | 589.61 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]-5-[3-(2,2,2-trifluoroethoxy)phenyl]furan-2-carboxamide |
| SMILES | CCCCC[C@H](CN(C=O)OCc1ccccc1)C(=O)NCNC(=O)c1ccc(-c2cccc(OCC(F)(F)F)c2)o1 |
| InChI | InChI=1S/C30H34F3N3O6/c1-2-3-5-11-24(17-36(21-37)41-18-22-9-6-4-7-10-22)28(38)34-20-35-29(39)27-15-14-26(42-27)23-12-8-13-25(16-23)40-19-30(31,32)33/h4,6-10,12-16,21,24H,2-3,5,11,17-20H2,1H3,(H,34,38)(H,35,39)/t24-/m1/s1 |
| InChIKey | YDAFZCFFDBRFRV-XMMPIXPASA-N |
| XLogP | 5.48 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.61 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|