C31H31N3O5 — CID 122698986
N-[[[2-[[formyl(phenylmethoxy)amino]methyl]-4-phenylbutanoyl]amino]methyl]-5-phenylfuran-2-carboxamide (PubChem CID 122698986) has the molecular formula C31H31N3O5 and a molecular weight of 525.61 g/mol. Its IUPAC name is N-[[[2-[[formyl(phenylmethoxy)amino]methyl]-4-phenylbutanoyl]amino]methyl]-5-phenylfuran-2-carboxamide.
| Compound Name | N-[[[2-[[formyl(phenylmethoxy)amino]methyl]-4-phenylbutanoyl]amino]methyl]-5-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 122698986 |
| Molecular Formula | C31H31N3O5 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | N-[[[2-[[formyl(phenylmethoxy)amino]methyl]-4-phenylbutanoyl]amino]methyl]-5-phenylfuran-2-carboxamide |
| SMILES | O=CN(CC(CCc1ccccc1)C(=O)NCNC(=O)c1ccc(-c2ccccc2)o1)OCc1ccccc1 |
| InChI | InChI=1S/C31H31N3O5/c35-23-34(38-21-25-12-6-2-7-13-25)20-27(17-16-24-10-4-1-5-11-24)30(36)32-22-33-31(37)29-19-18-28(39-29)26-14-8-3-9-15-26/h1-15,18-19,23,27H,16-17,20-22H2,(H,32,36)(H,33,37) |
| InChIKey | VUNPXZXTNAJAIO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|