C31H39N3O7 — CID 146199585
5-(2,5-dimethoxyphenyl)-N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]octanoyl]amino]methyl]furan-2-carboxamide (PubChem CID 146199585) has the molecular formula C31H39N3O7 and a molecular weight of 565.67 g/mol. Its IUPAC name is 5-(2,5-dimethoxyphenyl)-N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]octanoyl]amino]methyl]furan-2-carboxamide.
| Compound Name | 5-(2,5-dimethoxyphenyl)-N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]octanoyl]amino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 146199585 |
| Molecular Formula | C31H39N3O7 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.28 |
| IUPAC Name | 5-(2,5-dimethoxyphenyl)-N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]octanoyl]amino]methyl]furan-2-carboxamide |
| SMILES | CCCCCC[C@H](CN(C=O)OCc1ccccc1)C(=O)NCNC(=O)c1ccc(-c2cc(OC)ccc2OC)o1 |
| InChI | InChI=1S/C31H39N3O7/c1-4-5-6-10-13-24(19-34(22-35)40-20-23-11-8-7-9-12-23)30(36)32-21-33-31(37)29-17-16-28(41-29)26-18-25(38-2)14-15-27(26)39-3/h7-9,11-12,14-18,22,24H,4-6,10,13,19-21H2,1-3H3,(H,32,36)(H,33,37)/t24-/m1/s1 |
| InChIKey | IMOAJLFKLHOOCZ-XMMPIXPASA-N |
| XLogP | 4.94 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|