C22H28BrN3O5 — CID 118225866
5-bromo-N-[[2-[[formyl(phenylmethoxy)amino]methyl]heptanoylamino]methyl]furan-2-carboxamide (PubChem CID 118225866) has the molecular formula C22H28BrN3O5 and a molecular weight of 494.39 g/mol. Its IUPAC name is 5-bromo-N-[[2-[[formyl(phenylmethoxy)amino]methyl]heptanoylamino]methyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[[2-[[formyl(phenylmethoxy)amino]methyl]heptanoylamino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 118225866 |
| Molecular Formula | C22H28BrN3O5 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 5-bromo-N-[[2-[[formyl(phenylmethoxy)amino]methyl]heptanoylamino]methyl]furan-2-carboxamide |
| SMILES | CCCCCC(CN(C=O)OCc1ccccc1)C(=O)NCNC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C22H28BrN3O5/c1-2-3-5-10-18(13-26(16-27)30-14-17-8-6-4-7-9-17)21(28)24-15-25-22(29)19-11-12-20(23)31-19/h4,6-9,11-12,16,18H,2-3,5,10,13-15H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | LYRAIHQUYZJDIA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|