C29H36N4O7S — CID 122699079
N-[[2-[[formyl(phenylmethoxy)amino]methyl]heptanoylamino]methyl]-5-[3-(methylsulfamoyl)phenyl]furan-2-carboxamide (PubChem CID 122699079) has the molecular formula C29H36N4O7S and a molecular weight of 584.70 g/mol. Its IUPAC name is N-[[2-[[formyl(phenylmethoxy)amino]methyl]heptanoylamino]methyl]-5-[3-(methylsulfamoyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[[2-[[formyl(phenylmethoxy)amino]methyl]heptanoylamino]methyl]-5-[3-(methylsulfamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 122699079 |
| Molecular Formula | C29H36N4O7S |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | N-[[2-[[formyl(phenylmethoxy)amino]methyl]heptanoylamino]methyl]-5-[3-(methylsulfamoyl)phenyl]furan-2-carboxamide |
| SMILES | CCCCCC(CN(C=O)OCc1ccccc1)C(=O)NCNC(=O)c1ccc(-c2cccc(S(=O)(=O)NC)c2)o1 |
| InChI | InChI=1S/C29H36N4O7S/c1-3-4-6-12-24(18-33(21-34)39-19-22-10-7-5-8-11-22)28(35)31-20-32-29(36)27-16-15-26(40-27)23-13-9-14-25(17-23)41(37,38)30-2/h5,7-11,13-17,21,24,30H,3-4,6,12,18-20H2,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | YXYKXPIGQLQSPU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 147.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|