C22H28N3O7P — CID 122699015
N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-[3-(phosphorosooxymethyl)phenyl]furan-2-carboxamide (PubChem CID 122699015) has the molecular formula C22H28N3O7P and a molecular weight of 477.45 g/mol. Its IUPAC name is N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-[3-(phosphorosooxymethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-[3-(phosphorosooxymethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 122699015 |
| Molecular Formula | C22H28N3O7P |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-[3-(phosphorosooxymethyl)phenyl]furan-2-carboxamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NCNC(=O)c1ccc(-c2cccc(COP=O)c2)o1 |
| InChI | InChI=1S/C22H28N3O7P/c1-2-3-4-7-18(12-25(29)15-26)21(27)23-14-24-22(28)20-10-9-19(32-20)17-8-5-6-16(11-17)13-31-33-30/h5-6,8-11,15,18,29H,2-4,7,12-14H2,1H3,(H,23,27)(H,24,28)/t18-/m1/s1 |
| InChIKey | QOTHXZBAVKHQLG-GOSISDBHSA-N |
| XLogP | 3.52 |
| TPSA | 138.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|