C23H29N5O5 — CID 118225800
N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-(1-methylindazol-6-yl)furan-2-carboxamide (PubChem CID 118225800) has the molecular formula C23H29N5O5 and a molecular weight of 455.52 g/mol. Its IUPAC name is N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-(1-methylindazol-6-yl)furan-2-carboxamide.
| Compound Name | N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-(1-methylindazol-6-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 118225800 |
| Molecular Formula | C23H29N5O5 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-(1-methylindazol-6-yl)furan-2-carboxamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NCNC(=O)c1ccc(-c2ccc3cnn(C)c3c2)o1 |
| InChI | InChI=1S/C23H29N5O5/c1-3-4-5-6-18(13-28(32)15-29)22(30)24-14-25-23(31)21-10-9-20(33-21)16-7-8-17-12-26-27(2)19(17)11-16/h7-12,15,18,32H,3-6,13-14H2,1-2H3,(H,24,30)(H,25,31)/t18-/m1/s1 |
| InChIKey | CGBVFJHQHOTGBW-GOSISDBHSA-N |
| XLogP | 2.68 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|