C21H29N5O4 — CID 145227824
N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-3-(4-methylpyrazol-1-yl)benzamide (PubChem CID 145227824) has the molecular formula C21H29N5O4 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-3-(4-methylpyrazol-1-yl)benzamide.
| Compound Name | N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-3-(4-methylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 145227824 |
| Molecular Formula | C21H29N5O4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-3-(4-methylpyrazol-1-yl)benzamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NCNC(=O)c1cccc(-n2cc(C)cn2)c1 |
| InChI | InChI=1S/C21H29N5O4/c1-3-4-5-7-18(13-25(30)15-27)21(29)23-14-22-20(28)17-8-6-9-19(10-17)26-12-16(2)11-24-26/h6,8-12,15,18,30H,3-5,7,13-14H2,1-2H3,(H,22,28)(H,23,29)/t18-/m1/s1 |
| InChIKey | PNHGGNMGADAUBF-GOSISDBHSA-N |
| XLogP | 2.03 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|