C23H31N5O6 — CID 145227804
3-(3,6-dimethoxypyridazin-4-yl)-N-[[2-[[formyl(hydroxy)amino]methyl]heptanoylamino]methyl]benzamide (PubChem CID 145227804) has the molecular formula C23H31N5O6 and a molecular weight of 473.53 g/mol. Its IUPAC name is 3-(3,6-dimethoxypyridazin-4-yl)-N-[[2-[[formyl(hydroxy)amino]methyl]heptanoylamino]methyl]benzamide.
| Compound Name | 3-(3,6-dimethoxypyridazin-4-yl)-N-[[2-[[formyl(hydroxy)amino]methyl]heptanoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 145227804 |
| Molecular Formula | C23H31N5O6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 3-(3,6-dimethoxypyridazin-4-yl)-N-[[2-[[formyl(hydroxy)amino]methyl]heptanoylamino]methyl]benzamide |
| SMILES | CCCCCC(CN(O)C=O)C(=O)NCNC(=O)c1cccc(-c2cc(OC)nnc2OC)c1 |
| InChI | InChI=1S/C23H31N5O6/c1-4-5-6-8-18(13-28(32)15-29)22(31)25-14-24-21(30)17-10-7-9-16(11-17)19-12-20(33-2)26-27-23(19)34-3/h7,9-12,15,18,32H,4-6,8,13-14H2,1-3H3,(H,24,30)(H,25,31) |
| InChIKey | OYRYVUXUXOPILW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 142.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|