C24H30FN3O5 — CID 154505330
2-fluoro-N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-3-(3-methoxyphenyl)benzamide (PubChem CID 154505330) has the molecular formula C24H30FN3O5 and a molecular weight of 459.52 g/mol. Its IUPAC name is 2-fluoro-N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-3-(3-methoxyphenyl)benzamide.
| Compound Name | 2-fluoro-N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-3-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 154505330 |
| Molecular Formula | C24H30FN3O5 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 2-fluoro-N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-3-(3-methoxyphenyl)benzamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NCNC(=O)c1cccc(-c2cccc(OC)c2)c1F |
| InChI | InChI=1S/C24H30FN3O5/c1-3-4-5-8-18(14-28(32)16-29)23(30)26-15-27-24(31)21-12-7-11-20(22(21)25)17-9-6-10-19(13-17)33-2/h6-7,9-13,16,18,32H,3-5,8,14-15H2,1-2H3,(H,26,30)(H,27,31)/t18-/m1/s1 |
| InChIKey | DLGBOWKOIPAXPY-GOSISDBHSA-N |
| XLogP | 3.35 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|