C23H29N3O8 — CID 118226239
5-[5-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-methoxybenzoic acid (PubChem CID 118226239) has the molecular formula C23H29N3O8 and a molecular weight of 475.50 g/mol. Its IUPAC name is 5-[5-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-methoxybenzoic acid.
| Compound Name | 5-[5-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 118226239 |
| Molecular Formula | C23H29N3O8 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 5-[5-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-methoxybenzoic acid |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NCNC(=O)c1ccc(-c2ccc(OC)c(C(=O)O)c2)o1 |
| InChI | InChI=1S/C23H29N3O8/c1-3-4-5-6-16(12-26(32)14-27)21(28)24-13-25-22(29)20-10-9-18(34-20)15-7-8-19(33-2)17(11-15)23(30)31/h7-11,14,16,32H,3-6,12-13H2,1-2H3,(H,24,28)(H,25,29)(H,30,31)/t16-/m1/s1 |
| InChIKey | ZTTURGWCXSPSPO-MRXNPFEDSA-N |
| XLogP | 2.50 |
| TPSA | 158.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|