C27H38N4O7 — CID 159180945
5-[3-(4-aminobutanoyl)-5-ethoxyphenyl]-N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]furan-2-carboxamide (PubChem CID 159180945) has the molecular formula C27H38N4O7 and a molecular weight of 530.62 g/mol. Its IUPAC name is 5-[3-(4-aminobutanoyl)-5-ethoxyphenyl]-N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]furan-2-carboxamide.
| Compound Name | 5-[3-(4-aminobutanoyl)-5-ethoxyphenyl]-N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 159180945 |
| Molecular Formula | C27H38N4O7 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 5-[3-(4-aminobutanoyl)-5-ethoxyphenyl]-N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]furan-2-carboxamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(C(=O)CCCN)c2)o1 |
| InChI | InChI=1S/C27H38N4O7/c1-3-5-6-8-19(16-31(36)18-32)26(34)29-17-30-27(35)25-11-10-24(38-25)21-13-20(23(33)9-7-12-28)14-22(15-21)37-4-2/h10-11,13-15,18-19,36H,3-9,12,16-17,28H2,1-2H3,(H,29,34)(H,30,35)/t19-/m1/s1 |
| InChIKey | KMWOQHJOMRXOGQ-LJQANCHMSA-N |
| XLogP | 3.11 |
| TPSA | 164.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|