C30H37N3O7 — CID 118226077
3-ethoxy-5-[5-[[2-[(phenylmethoxyamino)methyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoic acid (PubChem CID 118226077) has the molecular formula C30H37N3O7 and a molecular weight of 551.64 g/mol. Its IUPAC name is 3-ethoxy-5-[5-[[2-[(phenylmethoxyamino)methyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoic acid.
| Compound Name | 3-ethoxy-5-[5-[[2-[(phenylmethoxyamino)methyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 118226077 |
| Molecular Formula | C30H37N3O7 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 3-ethoxy-5-[5-[[2-[(phenylmethoxyamino)methyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoic acid |
| SMILES | CCCCCC(CNOCc1ccccc1)C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(C(=O)O)c2)o1 |
| InChI | InChI=1S/C30H37N3O7/c1-3-5-7-12-22(18-33-39-19-21-10-8-6-9-11-21)28(34)31-20-32-29(35)27-14-13-26(40-27)23-15-24(30(36)37)17-25(16-23)38-4-2/h6,8-11,13-17,22,33H,3-5,7,12,18-20H2,1-2H3,(H,31,34)(H,32,35)(H,36,37) |
| InChIKey | CHQGMLDALJGGGM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 139.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|