C30H44N4O10 — CID 141460707
(2R,3R)-N-[[[5-[3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamoyl]-5-ethoxyphenyl]furan-2-carbonyl]amino]methyl]-3-ethyl-N'-hydroxy-2-pentylbutanediamide (PubChem CID 141460707) has the molecular formula C30H44N4O10 and a molecular weight of 620.70 g/mol. Its IUPAC name is (2R,3R)-N-[[[5-[3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamoyl]-5-ethoxyphenyl]furan-2-carbonyl]amino]methyl]-3-ethyl-N'-hydroxy-2-pentylbutanediamide.
| Compound Name | (2R,3R)-N-[[[5-[3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamoyl]-5-ethoxyphenyl]furan-2-carbonyl]amino]methyl]-3-ethyl-N'-hydroxy-2-pentylbutanediamide |
|---|---|
| PubChem CID | 141460707 |
| Molecular Formula | C30H44N4O10 |
| Molecular Weight | 620.70 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | (2R,3R)-N-[[[5-[3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamoyl]-5-ethoxyphenyl]furan-2-carbonyl]amino]methyl]-3-ethyl-N'-hydroxy-2-pentylbutanediamide |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(C(=O)NC(CO)(CO)CO)c2)o1)[C@@H](CC)C(=O)NO |
| InChI | InChI=1S/C30H44N4O10/c1-4-7-8-9-23(22(5-2)28(40)34-42)27(39)31-18-32-29(41)25-11-10-24(44-25)19-12-20(14-21(13-19)43-6-3)26(38)33-30(15-35,16-36)17-37/h10-14,22-23,35-37,42H,4-9,15-18H2,1-3H3,(H,31,39)(H,32,41)(H,33,38)(H,34,40)/t22-,23-/m1/s1 |
| InChIKey | MVUOHOFMKWXEOO-DHIUTWEWSA-N |
| XLogP | 1.32 |
| TPSA | 219.69 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.70 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|