C30H40N4O11 — CID 141460798
(2R)-2-[[3-ethoxy-5-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid (PubChem CID 141460798) has the molecular formula C30H40N4O11 and a molecular weight of 632.67 g/mol. Its IUPAC name is (2R)-2-[[3-ethoxy-5-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid.
| Compound Name | (2R)-2-[[3-ethoxy-5-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 141460798 |
| Molecular Formula | C30H40N4O11 |
| Molecular Weight | 632.67 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | (2R)-2-[[3-ethoxy-5-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(C(=O)N[C@H](CC(=O)O)C(=O)O)c2)o1)[C@@H](CC)C(=O)NO |
| InChI | InChI=1S/C30H40N4O11/c1-4-7-8-9-21(20(5-2)28(39)34-43)27(38)31-16-32-29(40)24-11-10-23(45-24)17-12-18(14-19(13-17)44-6-3)26(37)33-22(30(41)42)15-25(35)36/h10-14,20-22,43H,4-9,15-16H2,1-3H3,(H,31,38)(H,32,40)(H,33,37)(H,34,39)(H,35,36)(H,41,42)/t20-,21-,22-/m1/s1 |
| InChIKey | SIZSJHQRBJLSLL-YPAWHYETSA-N |
| XLogP | 2.53 |
| TPSA | 233.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.67 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|