C27H35N3O7 — CID 141460866
1-[3-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]phenyl]cyclopropane-1-carboxylic acid (PubChem CID 141460866) has the molecular formula C27H35N3O7 and a molecular weight of 513.59 g/mol. Its IUPAC name is 1-[3-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[3-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 141460866 |
| Molecular Formula | C27H35N3O7 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | 1-[3-[5-[[[(2R)-2-[(2R)-1-(hydroxyamino)-1-oxobutan-2-yl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]phenyl]cyclopropane-1-carboxylic acid |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2cccc(C3(C(=O)O)CC3)c2)o1)[C@@H](CC)C(=O)NO |
| InChI | InChI=1S/C27H35N3O7/c1-3-5-6-10-20(19(4-2)24(32)30-36)23(31)28-16-29-25(33)22-12-11-21(37-22)17-8-7-9-18(15-17)27(13-14-27)26(34)35/h7-9,11-12,15,19-20,36H,3-6,10,13-14,16H2,1-2H3,(H,28,31)(H,29,33)(H,30,32)(H,34,35)/t19-,20-/m1/s1 |
| InChIKey | AFLDMPBBEDPAOY-WOJBJXKFSA-N |
| XLogP | 3.59 |
| TPSA | 157.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|