C25H33N3O6 — CID 137361708
[formyl-[(3R)-4-[[(5-phenylfuran-2-carbonyl)amino]methylcarbamoyl]nonan-3-yl]amino] acetate (PubChem CID 137361708) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is [formyl-[(3R)-4-[[(5-phenylfuran-2-carbonyl)amino]methylcarbamoyl]nonan-3-yl]amino] acetate.
| Compound Name | [formyl-[(3R)-4-[[(5-phenylfuran-2-carbonyl)amino]methylcarbamoyl]nonan-3-yl]amino] acetate |
|---|---|
| PubChem CID | 137361708 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | [formyl-[(3R)-4-[[(5-phenylfuran-2-carbonyl)amino]methylcarbamoyl]nonan-3-yl]amino] acetate |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2ccccc2)o1)[C@@H](CC)N(C=O)OC(C)=O |
| InChI | InChI=1S/C25H33N3O6/c1-4-6-8-13-20(21(5-2)28(17-29)34-18(3)30)24(31)26-16-27-25(32)23-15-14-22(33-23)19-11-9-7-10-12-19/h7,9-12,14-15,17,20-21H,4-6,8,13,16H2,1-3H3,(H,26,31)(H,27,32)/t20?,21-/m1/s1 |
| InChIKey | YBHVNUFMGQWIPR-BPGUCPLFSA-N |
| XLogP | 3.66 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|