C31H37N3O6 — CID 145228265
[formyl-[4-[[(5-phenylfuran-2-carbonyl)amino]methylcarbamoyl]nonan-3-yl]amino] 2-phenylacetate (PubChem CID 145228265) has the molecular formula C31H37N3O6 and a molecular weight of 547.65 g/mol. Its IUPAC name is [formyl-[4-[[(5-phenylfuran-2-carbonyl)amino]methylcarbamoyl]nonan-3-yl]amino] 2-phenylacetate.
| Compound Name | [formyl-[4-[[(5-phenylfuran-2-carbonyl)amino]methylcarbamoyl]nonan-3-yl]amino] 2-phenylacetate |
|---|---|
| PubChem CID | 145228265 |
| Molecular Formula | C31H37N3O6 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | [formyl-[4-[[(5-phenylfuran-2-carbonyl)amino]methylcarbamoyl]nonan-3-yl]amino] 2-phenylacetate |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2ccccc2)o1)C(CC)N(C=O)OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C31H37N3O6/c1-3-5-8-17-25(26(4-2)34(22-35)40-29(36)20-23-13-9-6-10-14-23)30(37)32-21-33-31(38)28-19-18-27(39-28)24-15-11-7-12-16-24/h6-7,9-16,18-19,22,25-26H,3-5,8,17,20-21H2,1-2H3,(H,32,37)(H,33,38) |
| InChIKey | DIMDZBGALIQNMU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|