C32H39N3O8 — CID 118225732
methyl 3-[5-[[2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-5-hydroxybenzoate (PubChem CID 118225732) has the molecular formula C32H39N3O8 and a molecular weight of 593.68 g/mol. Its IUPAC name is methyl 3-[5-[[2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-5-hydroxybenzoate.
| Compound Name | methyl 3-[5-[[2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-5-hydroxybenzoate |
|---|---|
| PubChem CID | 118225732 |
| Molecular Formula | C32H39N3O8 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | methyl 3-[5-[[2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-5-hydroxybenzoate |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(O)cc(C(=O)OC)c2)o1)[C@@H](CC)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H39N3O8/c1-4-6-8-13-26(27(5-2)35(21-36)42-19-22-11-9-7-10-12-22)30(38)33-20-34-31(39)29-15-14-28(43-29)23-16-24(32(40)41-3)18-25(37)17-23/h7,9-12,14-18,21,26-27,37H,4-6,8,13,19-20H2,1-3H3,(H,33,38)(H,34,39)/t26?,27-/m1/s1 |
| InChIKey | QIHDPKBWTLGBLA-SSYAZFEXSA-N |
| XLogP | 4.81 |
| TPSA | 147.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|