C29H38N4O10 — CID 118226290
2-[[4-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]pentanedioic acid (PubChem CID 118226290) has the molecular formula C29H38N4O10 and a molecular weight of 602.64 g/mol. Its IUPAC name is 2-[[4-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]pentanedioic acid.
| Compound Name | 2-[[4-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 118226290 |
| Molecular Formula | C29H38N4O10 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | 2-[[4-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]pentanedioic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc2)o1)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C29H38N4O10/c1-3-5-6-7-20(22(4-2)33(42)17-34)27(38)30-16-31-28(39)24-14-13-23(43-24)18-8-10-19(11-9-18)26(37)32-21(29(40)41)12-15-25(35)36/h8-11,13-14,17,20-22,42H,3-7,12,15-16H2,1-2H3,(H,30,38)(H,31,39)(H,32,37)(H,35,36)(H,40,41)/t20?,21?,22-/m1/s1 |
| InChIKey | RUYMDOGBHBEVHI-LZBANZJXSA-N |
| XLogP | 2.62 |
| TPSA | 215.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|