C30H42N4O10 — CID 144883959
N-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methyl]-5-(4-formylphenyl)furan-2-carboxamide;2-(methylamino)pentanedioic acid (PubChem CID 144883959) has the molecular formula C30H42N4O10 and a molecular weight of 618.68 g/mol. Its IUPAC name is N-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methyl]-5-(4-formylphenyl)furan-2-carboxamide;2-(methylamino)pentanedioic acid.
| Compound Name | N-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methyl]-5-(4-formylphenyl)furan-2-carboxamide;2-(methylamino)pentanedioic acid |
|---|---|
| PubChem CID | 144883959 |
| Molecular Formula | C30H42N4O10 |
| Molecular Weight | 618.68 g/mol |
| Exact Mass | 618.29 |
| IUPAC Name | N-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methyl]-5-(4-formylphenyl)furan-2-carboxamide;2-(methylamino)pentanedioic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2ccc(C=O)cc2)o1)C(CC)N(O)C=O.CNC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H31N3O6.C6H11NO4/c1-3-5-6-7-19(20(4-2)27(32)16-29)23(30)25-15-26-24(31)22-13-12-21(33-22)18-10-8-17(14-28)9-11-18;1-7-4(6(10)11)2-3-5(8)9/h8-14,16,19-20,32H,3-7,15H2,1-2H3,(H,25,30)(H,26,31);4,7H,2-3H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | IYDFPWVXJJYAJF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 215.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.68 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|