C38H53N4O10P — CID 141460735
(2R,3R)-N-[[[5-[3-(diethoxyphosphorylmethylcarbamoyl)-5-ethoxyphenyl]furan-2-carbonyl]amino]methyl]-3-ethyl-2-pentyl-N'-phenylmethoxybutanediamide (PubChem CID 141460735) has the molecular formula C38H53N4O10P and a molecular weight of 756.83 g/mol. Its IUPAC name is (2R,3R)-N-[[[5-[3-(diethoxyphosphorylmethylcarbamoyl)-5-ethoxyphenyl]furan-2-carbonyl]amino]methyl]-3-ethyl-2-pentyl-N'-phenylmethoxybutanediamide.
| Compound Name | (2R,3R)-N-[[[5-[3-(diethoxyphosphorylmethylcarbamoyl)-5-ethoxyphenyl]furan-2-carbonyl]amino]methyl]-3-ethyl-2-pentyl-N'-phenylmethoxybutanediamide |
|---|---|
| PubChem CID | 141460735 |
| Molecular Formula | C38H53N4O10P |
| Molecular Weight | 756.83 g/mol |
| Exact Mass | 756.35 |
| IUPAC Name | (2R,3R)-N-[[[5-[3-(diethoxyphosphorylmethylcarbamoyl)-5-ethoxyphenyl]furan-2-carbonyl]amino]methyl]-3-ethyl-2-pentyl-N'-phenylmethoxybutanediamide |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(C(=O)NCP(=O)(OCC)OCC)c2)o1)[C@@H](CC)C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C38H53N4O10P/c1-6-11-13-18-32(31(7-2)37(45)42-49-24-27-16-14-12-15-17-27)36(44)39-25-40-38(46)34-20-19-33(52-34)28-21-29(23-30(22-28)48-8-3)35(43)41-26-53(47,50-9-4)51-10-5/h12,14-17,19-23,31-32H,6-11,13,18,24-26H2,1-5H3,(H,39,44)(H,40,46)(H,41,43)(H,42,45)/t31-,32-/m1/s1 |
| InChIKey | OENUHJHGRWSNQZ-ROJLCIKYSA-N |
| XLogP | 6.57 |
| TPSA | 183.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.83 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|