C36H49N4O9P — CID 141460862
(2R,3R)-N-[[[5-[4-(diethoxyphosphorylmethylcarbamoyl)phenyl]furan-2-carbonyl]amino]methyl]-3-ethyl-2-pentyl-N'-phenylmethoxybutanediamide (PubChem CID 141460862) has the molecular formula C36H49N4O9P and a molecular weight of 712.78 g/mol. Its IUPAC name is (2R,3R)-N-[[[5-[4-(diethoxyphosphorylmethylcarbamoyl)phenyl]furan-2-carbonyl]amino]methyl]-3-ethyl-2-pentyl-N'-phenylmethoxybutanediamide.
| Compound Name | (2R,3R)-N-[[[5-[4-(diethoxyphosphorylmethylcarbamoyl)phenyl]furan-2-carbonyl]amino]methyl]-3-ethyl-2-pentyl-N'-phenylmethoxybutanediamide |
|---|---|
| PubChem CID | 141460862 |
| Molecular Formula | C36H49N4O9P |
| Molecular Weight | 712.78 g/mol |
| Exact Mass | 712.32 |
| IUPAC Name | (2R,3R)-N-[[[5-[4-(diethoxyphosphorylmethylcarbamoyl)phenyl]furan-2-carbonyl]amino]methyl]-3-ethyl-2-pentyl-N'-phenylmethoxybutanediamide |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2ccc(C(=O)NCP(=O)(OCC)OCC)cc2)o1)[C@@H](CC)C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C36H49N4O9P/c1-5-9-11-16-30(29(6-2)35(43)40-46-23-26-14-12-10-13-15-26)34(42)37-24-38-36(44)32-22-21-31(49-32)27-17-19-28(20-18-27)33(41)39-25-50(45,47-7-3)48-8-4/h10,12-15,17-22,29-30H,5-9,11,16,23-25H2,1-4H3,(H,37,42)(H,38,44)(H,39,41)(H,40,43)/t29-,30-/m1/s1 |
| InChIKey | BSIZEVCIPCDWLS-LOYHVIPDSA-N |
| XLogP | 6.17 |
| TPSA | 174.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.78 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|