C19H25N3O6 — CID 88849206
1-benzofuran-2-yl N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]carbamate (PubChem CID 88849206) has the molecular formula C19H25N3O6 and a molecular weight of 391.42 g/mol. Its IUPAC name is 1-benzofuran-2-yl N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]carbamate.
| Compound Name | 1-benzofuran-2-yl N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]carbamate |
|---|---|
| PubChem CID | 88849206 |
| Molecular Formula | C19H25N3O6 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-benzofuran-2-yl N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]carbamate |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NCNC(=O)Oc1cc2ccccc2o1 |
| InChI | InChI=1S/C19H25N3O6/c1-2-3-4-8-15(11-22(26)13-23)18(24)20-12-21-19(25)28-17-10-14-7-5-6-9-16(14)27-17/h5-7,9-10,13,15,26H,2-4,8,11-12H2,1H3,(H,20,24)(H,21,25)/t15-/m1/s1 |
| InChIKey | VOXXGNIEPUFGME-OAHLLOKOSA-N |
| XLogP | 2.64 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|