C32H37N3O4 — CID 145227985
3-(3-ethenylphenyl)-N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]benzamide (PubChem CID 145227985) has the molecular formula C32H37N3O4 and a molecular weight of 527.67 g/mol. Its IUPAC name is 3-(3-ethenylphenyl)-N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]benzamide.
| Compound Name | 3-(3-ethenylphenyl)-N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 145227985 |
| Molecular Formula | C32H37N3O4 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | 3-(3-ethenylphenyl)-N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]benzamide |
| SMILES | C=Cc1cccc(-c2cccc(C(=O)NCNC(=O)[C@H](CCCCC)CN(C=O)OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C32H37N3O4/c1-3-5-7-15-30(21-35(24-36)39-22-26-12-8-6-9-13-26)32(38)34-23-33-31(37)29-18-11-17-28(20-29)27-16-10-14-25(4-2)19-27/h4,6,8-14,16-20,24,30H,2-3,5,7,15,21-23H2,1H3,(H,33,37)(H,34,38)/t30-/m1/s1 |
| InChIKey | HBASKFNTUZWFCL-SSEXGKCCSA-N |
| XLogP | 5.59 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|