C32H39N3O5 — CID 144883839
2-[[formyl(phenylmethoxy)amino]methyl]-N-[[1-[5-[3-(2-oxopropyl)phenyl]furan-2-yl]ethenylamino]methyl]heptanamide (PubChem CID 144883839) has the molecular formula C32H39N3O5 and a molecular weight of 545.68 g/mol. Its IUPAC name is 2-[[formyl(phenylmethoxy)amino]methyl]-N-[[1-[5-[3-(2-oxopropyl)phenyl]furan-2-yl]ethenylamino]methyl]heptanamide.
| Compound Name | 2-[[formyl(phenylmethoxy)amino]methyl]-N-[[1-[5-[3-(2-oxopropyl)phenyl]furan-2-yl]ethenylamino]methyl]heptanamide |
|---|---|
| PubChem CID | 144883839 |
| Molecular Formula | C32H39N3O5 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | 2-[[formyl(phenylmethoxy)amino]methyl]-N-[[1-[5-[3-(2-oxopropyl)phenyl]furan-2-yl]ethenylamino]methyl]heptanamide |
| SMILES | C=C(NCNC(=O)C(CCCCC)CN(C=O)OCc1ccccc1)c1ccc(-c2cccc(CC(C)=O)c2)o1 |
| InChI | InChI=1S/C32H39N3O5/c1-4-5-7-14-29(20-35(23-36)39-21-26-11-8-6-9-12-26)32(38)34-22-33-25(3)30-16-17-31(40-30)28-15-10-13-27(19-28)18-24(2)37/h6,8-13,15-17,19,23,29,33H,3-5,7,14,18,20-22H2,1-2H3,(H,34,38) |
| InChIKey | WGLMBEKJZPQGLP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|