C28H34N4O6 — CID 118230838
N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]-5-(6-methoxy-2-pyridinyl)furan-2-carboxamide (PubChem CID 118230838) has the molecular formula C28H34N4O6 and a molecular weight of 522.60 g/mol. Its IUPAC name is N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]-5-(6-methoxy-2-pyridinyl)furan-2-carboxamide.
| Compound Name | N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]-5-(6-methoxy-2-pyridinyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 118230838 |
| Molecular Formula | C28H34N4O6 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]-5-(6-methoxy-2-pyridinyl)furan-2-carboxamide |
| SMILES | CCCCC[C@H](CN(C=O)OCc1ccccc1)C(=O)NCNC(=O)c1ccc(-c2cccc(OC)n2)o1 |
| InChI | InChI=1S/C28H34N4O6/c1-3-4-6-12-22(17-32(20-33)37-18-21-10-7-5-8-11-21)27(34)29-19-30-28(35)25-16-15-24(38-25)23-13-9-14-26(31-23)36-2/h5,7-11,13-16,20,22H,3-4,6,12,17-19H2,1-2H3,(H,29,34)(H,30,35)/t22-/m1/s1 |
| InChIKey | XHAPGSZYQCFYQX-JOCHJYFZSA-N |
| XLogP | 3.94 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|