C29H33N3O5 — CID 122699037
N-[[[2-(cyclopentylmethyl)-3-[formyl(phenylmethoxy)amino]propanoyl]amino]methyl]-5-phenylfuran-2-carboxamide (PubChem CID 122699037) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is N-[[[2-(cyclopentylmethyl)-3-[formyl(phenylmethoxy)amino]propanoyl]amino]methyl]-5-phenylfuran-2-carboxamide.
| Compound Name | N-[[[2-(cyclopentylmethyl)-3-[formyl(phenylmethoxy)amino]propanoyl]amino]methyl]-5-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 122699037 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | N-[[[2-(cyclopentylmethyl)-3-[formyl(phenylmethoxy)amino]propanoyl]amino]methyl]-5-phenylfuran-2-carboxamide |
| SMILES | O=CN(CC(CC1CCCC1)C(=O)NCNC(=O)c1ccc(-c2ccccc2)o1)OCc1ccccc1 |
| InChI | InChI=1S/C29H33N3O5/c33-21-32(36-19-23-11-3-1-4-12-23)18-25(17-22-9-7-8-10-22)28(34)30-20-31-29(35)27-16-15-26(37-27)24-13-5-2-6-14-24/h1-6,11-16,21-22,25H,7-10,17-20H2,(H,30,34)(H,31,35) |
| InChIKey | JDGCEHVWJSVUKP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|