C25H32ClFN6O3 — CID 87210206
N-[(2S)-3-[2-[2-chloro-6-(cyclobutylamino)-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-phenylmethoxyformamide (PubChem CID 87210206) has the molecular formula C25H32ClFN6O3 and a molecular weight of 519.02 g/mol. Its IUPAC name is N-[(2S)-3-[2-[2-chloro-6-(cyclobutylamino)-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-phenylmethoxyformamide.
| Compound Name | N-[(2S)-3-[2-[2-chloro-6-(cyclobutylamino)-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 87210206 |
| Molecular Formula | C25H32ClFN6O3 |
| Molecular Weight | 519.02 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | N-[(2S)-3-[2-[2-chloro-6-(cyclobutylamino)-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-phenylmethoxyformamide |
| SMILES | O=CN(C[C@H](CC1CCCC1)C(=O)NNc1nc(Cl)nc(NC2CCC2)c1F)OCc1ccccc1 |
| InChI | InChI=1S/C25H32ClFN6O3/c26-25-29-22(28-20-11-6-12-20)21(27)23(30-25)31-32-24(35)19(13-17-7-4-5-8-17)14-33(16-34)36-15-18-9-2-1-3-10-18/h1-3,9-10,16-17,19-20H,4-8,11-15H2,(H,32,35)(H2,28,29,30,31)/t19-/m0/s1 |
| InChIKey | WARFSAFJEDSOCQ-IBGZPJMESA-N |
| XLogP | 4.46 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.02 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|