C28H40FN7O4 — CID 86636936
N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-(4-ethylpiperazin-1-yl)-5-fluoro-2-methoxypyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-phenylmethoxyformamide (PubChem CID 86636936) has the molecular formula C28H40FN7O4 and a molecular weight of 557.67 g/mol. Its IUPAC name is N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-(4-ethylpiperazin-1-yl)-5-fluoro-2-methoxypyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-phenylmethoxyformamide.
| Compound Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-(4-ethylpiperazin-1-yl)-5-fluoro-2-methoxypyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 86636936 |
| Molecular Formula | C28H40FN7O4 |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-(4-ethylpiperazin-1-yl)-5-fluoro-2-methoxypyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-phenylmethoxyformamide |
| SMILES | CCN1CCN(c2nc(OC)nc(NNC(=O)[C@H](CC3CCCC3)CN(C=O)OCc3ccccc3)c2F)CC1 |
| InChI | InChI=1S/C28H40FN7O4/c1-3-34-13-15-35(16-14-34)26-24(29)25(30-28(31-26)39-2)32-33-27(38)23(17-21-9-7-8-10-21)18-36(20-37)40-19-22-11-5-4-6-12-22/h4-6,11-12,20-21,23H,3,7-10,13-19H2,1-2H3,(H,33,38)(H,30,31,32)/t23-/m1/s1 |
| InChIKey | GEDBDVCTCDTUEX-HSZRJFAPSA-N |
| XLogP | 3.00 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|