C28H34FN7O3 — CID 87210160
N-[(2S)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(pyridin-2-ylmethylamino)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-phenylmethoxyformamide (PubChem CID 87210160) has the molecular formula C28H34FN7O3 and a molecular weight of 535.62 g/mol. Its IUPAC name is N-[(2S)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(pyridin-2-ylmethylamino)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-phenylmethoxyformamide.
| Compound Name | N-[(2S)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(pyridin-2-ylmethylamino)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 87210160 |
| Molecular Formula | C28H34FN7O3 |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | N-[(2S)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(pyridin-2-ylmethylamino)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-phenylmethoxyformamide |
| SMILES | Cc1nc(NCc2ccccn2)c(F)c(NNC(=O)[C@@H](CC2CCCC2)CN(C=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C28H34FN7O3/c1-20-32-26(31-16-24-13-7-8-14-30-24)25(29)27(33-20)34-35-28(38)23(15-21-9-5-6-10-21)17-36(19-37)39-18-22-11-3-2-4-12-22/h2-4,7-8,11-14,19,21,23H,5-6,9-10,15-18H2,1H3,(H,35,38)(H2,31,32,33,34)/t23-/m0/s1 |
| InChIKey | FVOSSOLGIKRPPP-QHCPKHFHSA-N |
| XLogP | 4.16 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|