C22H30FN7O3 — CID 58000649
N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-[methyl(pyridin-4-ylmethyl)amino]pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide (PubChem CID 58000649) has the molecular formula C22H30FN7O3 and a molecular weight of 459.53 g/mol. Its IUPAC name is N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-[methyl(pyridin-4-ylmethyl)amino]pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-[methyl(pyridin-4-ylmethyl)amino]pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58000649 |
| Molecular Formula | C22H30FN7O3 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-[methyl(pyridin-4-ylmethyl)amino]pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
| SMILES | Cc1nc(NNC(=O)[C@H](CC2CCCC2)CN(O)C=O)c(F)c(N(C)Cc2ccncc2)n1 |
| InChI | InChI=1S/C22H30FN7O3/c1-15-25-20(19(23)21(26-15)29(2)12-17-7-9-24-10-8-17)27-28-22(32)18(13-30(33)14-31)11-16-5-3-4-6-16/h7-10,14,16,18,33H,3-6,11-13H2,1-2H3,(H,28,32)(H,25,26,27)/t18-/m1/s1 |
| InChIKey | FLZADTMFQZLUQV-GOSISDBHSA-N |
| XLogP | 2.44 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|