C17H18FN5O — CID 11702619
N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide (PubChem CID 11702619) has the molecular formula C17H18FN5O and a molecular weight of 327.36 g/mol. Its IUPAC name is N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide.
| Compound Name | N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide |
|---|---|
| PubChem CID | 11702619 |
| Molecular Formula | C17H18FN5O |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide |
| SMILES | CC(C)CN(NC(=O)Cc1ccc(F)cc1)c1ccnc(C#N)n1 |
| InChI | InChI=1S/C17H18FN5O/c1-12(2)11-23(16-7-8-20-15(10-19)21-16)22-17(24)9-13-3-5-14(18)6-4-13/h3-8,12H,9,11H2,1-2H3,(H,22,24) |
| InChIKey | UZXPWXJTAVBSKD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|