About N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide
N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide (PubChem CID 11702619) has the molecular formula C17H18FN5O
and a molecular weight of 327.36 g/mol. Its IUPAC name is N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide.
Molecular Properties
| Compound Name | N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide |
| PubChem CID | 11702619 |
| Molecular Formula | C17H18FN5O |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide |
| SMILES | CC(C)CN(NC(=O)Cc1ccc(F)cc1)c1ccnc(C#N)n1 |
| InChI | InChI=1S/C17H18FN5O/c1-12(2)11-23(16-7-8-20-15(10-19)21-16)22-17(24)9-13-3-5-14(18)6-4-13/h3-8,12H,9,11H2,1-2H3,(H,22,24) |
| InChIKey | UZXPWXJTAVBSKD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide?
The IUPAC name of N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide (CID 11702619) is N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide.
What is the SMILES notation for N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide?
The canonical SMILES for N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide is CC(C)CN(NC(=O)Cc1ccc(F)cc1)c1ccnc(C#N)n1.
What is the InChIKey of N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide?
The InChIKey is UZXPWXJTAVBSKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN5O/c1-12(2)11-23(16-7-8-20-15(10-19)21-16)22-17(24)9-13-3-5-14(18)6-4-13/h3-8,12H,9,11H2,1-2H3,(H,22,24).
What are the key properties of N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide?
N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide has a molecular weight of 327.36 g/mol, XLogP of 2.22, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-cyanopyrimidin-4-yl)-2-(4-fluorophenyl)-N'-(2-methylpropyl)acetohydrazide is sourced from PubChem (CID 11702619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).