C18H21N5O2 — CID 3223137
N'-(2-phenylacetyl)-1-pyrimidin-2-ylpiperidine-4-carbohydrazide (PubChem CID 3223137) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is N'-(2-phenylacetyl)-1-pyrimidin-2-ylpiperidine-4-carbohydrazide.
| Compound Name | N'-(2-phenylacetyl)-1-pyrimidin-2-ylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 3223137 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N'-(2-phenylacetyl)-1-pyrimidin-2-ylpiperidine-4-carbohydrazide |
| SMILES | O=C(Cc1ccccc1)NNC(=O)C1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H21N5O2/c24-16(13-14-5-2-1-3-6-14)21-22-17(25)15-7-11-23(12-8-15)18-19-9-4-10-20-18/h1-6,9-10,15H,7-8,11-13H2,(H,21,24)(H,22,25) |
| InChIKey | VWBZPMDYLZDESQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|